CAS 1375745-18-8 is the registry number for 4-[[(1,3-Dihydro-2h-isoindol-2-yl)carbonyl]amino]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-(1,3-dihydroisoindole-2-carbonylamino)benzoic acid (CAS 1375745-18-8) is a chemical compound with the molecular formula C16H14N2O3 and a molecular weight of 282.29 g/mol. IUPAC name: 4-(1,3-dihydroisoindole-2-carbonylamino)benzoic acid. InChIKey: BXVMOEFTSXKEDP-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O3 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 4-(1,3-dihydroisoindole-2-carbonylamino)benzoic acid |
| InChIKey | BXVMOEFTSXKEDP-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2CN1C(=O)NC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)