CAS 1269529-74-9 appears in our catalog under these names: (4-Oxo-2-phenyl-1,4-dihydroquinazolin-3(2h)-yl)acetic acid, 95%, 2-(4-Oxo-2-phenyl-1,2-dihydroquinazolin-3(4H)-yl)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(4-oxo-2-phenyl-1,2-dihydroquinazolin-3-yl)acetic acid (CAS 1269529-74-9) is a chemical compound with the molecular formula C16H14N2O3 and a molecular weight of 282.29 g/mol. IUPAC name: 2-(4-oxo-2-phenyl-1,2-dihydroquinazolin-3-yl)acetic acid. InChIKey: NHURTHMESSUSJX-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O3 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 2-(4-oxo-2-phenyl-1,2-dihydroquinazolin-3-yl)acetic acid |
| InChIKey | NHURTHMESSUSJX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2NC3=CC=CC=C3C(=O)N2CC(=O)O |
Computed by PubChem (NCBI)