CAS 1364791-88-7 appears in our catalog under these names: DHODH–IN–15, DHODH-IN-15/ 97.26% (existing batch purity), DHODH-IN-15. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg.
4-oxo-N-(4-phenylphenyl)-1,2,5-oxadiazole-3-carboxamide (CAS 1364791-88-7) is a chemical compound with the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. IUPAC name: 4-oxo-N-(4-phenylphenyl)-1,2,5-oxadiazole-3-carboxamide. InChIKey: AIEVBDCDOIKIIK-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O3 |
|---|---|
| Molecular weight | 281.27 g/mol |
| IUPAC name | 4-oxo-N-(4-phenylphenyl)-1,2,5-oxadiazole-3-carboxamide |
| InChIKey | AIEVBDCDOIKIIK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC(=O)C3=NONC3=O |
Computed by PubChem (NCBI)