cas: 6164-77-8 — see every product listed under this CAS number, including other names
DIMETHYL PYRAZINE-2,3-DICARBOXYLATE, 95% (CAS 6164-77-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F513252-250MG |
| cas | 6164-77-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 857.01 Pln | |
| Fluorochem | 1g | 1596.33 Pln | |
| Fluorochem | 5g | 5761.53 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Dimethyl pyrazine-2,3-dicarboxylate (CAS 6164-77-8) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: dimethyl pyrazine-2,3-dicarboxylate. InChIKey: LZCUPFSEDRWYNU-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | dimethyl pyrazine-2,3-dicarboxylate |
| InChIKey | LZCUPFSEDRWYNU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=CN=C1C(=O)OC |
Computed by PubChem (NCBI)