cas: 53241-90-0 — see every product listed under this CAS number, including other names
DIethyl 2-{[(6-methoxypyridin-3-yl)amino]methylene}malonate, 95% (CAS 53241-90-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F689633-1G |
| cas | 53241-90-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 981.96 Pln | |
| Fluorochem | 10g | 1611.95 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Diethyl 2-[[(6-methoxy-3-pyridinyl)amino]methylidene]propanedioate (CAS 53241-90-0) is a chemical compound with the molecular formula C14H18N2O5 and a molecular weight of 294.30 g/mol. IUPAC name: diethyl 2-[[(6-methoxy-3-pyridinyl)amino]methylidene]propanedioate. InChIKey: FJDMNLFVZHBIHR-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O5 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | diethyl 2-[[(6-methoxy-3-pyridinyl)amino]methylidene]propanedioate |
| InChIKey | FJDMNLFVZHBIHR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CNC1=CN=C(C=C1)OC)C(=O)OCC |
Computed by PubChem (NCBI)