CAS 52407-60-0 is the registry number for Dimethyl (4-aminobenzoyl)-L-glutamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl (2S)-2-[(4-aminobenzoyl)amino]pentanedioate (CAS 52407-60-0) is a chemical compound with the molecular formula C14H18N2O5 and a molecular weight of 294.30 g/mol. IUPAC name: dimethyl (2S)-2-[(4-aminobenzoyl)amino]pentanedioate. InChIKey: KTNFJPQFZZYFPU-NSHDSACASA-N.
| Molecular formula | C14H18N2O5 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | dimethyl (2S)-2-[(4-aminobenzoyl)amino]pentanedioate |
| InChIKey | KTNFJPQFZZYFPU-NSHDSACASA-N |
| SMILES | COC(=O)CC[C@@H](C(=O)OC)NC(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)