CAS 81732-48-1 appears in our catalog under these names: 5-Acetyl-1,3-phenylene bis(dimethylcarbamate), 97%, Bambuterol EP Impurity E, Bambuterol Impurity 4, 5-Des(2-(tert-butylamino)) 5-Acetyl Bambuterol, >95% (HPLC), 5-Acetyl-1,3-phenylene Bis(dimethylcarbamate). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
[3-acetyl-5-(dimethylcarbamoyloxy)phenyl] N,N-dimethylcarbamate (CAS 81732-48-1) is a chemical compound with the molecular formula C14H18N2O5 and a molecular weight of 294.30 g/mol. IUPAC name: [3-acetyl-5-(dimethylcarbamoyloxy)phenyl] N,N-dimethylcarbamate. InChIKey: WTWHLMRXPNOZQX-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O5 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | [3-acetyl-5-(dimethylcarbamoyloxy)phenyl] N,N-dimethylcarbamate |
| InChIKey | WTWHLMRXPNOZQX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC(=C1)OC(=O)N(C)C)OC(=O)N(C)C |
Computed by PubChem (NCBI)