CAS 83793-19-5 appears in our catalog under these names: N2-Cbz-L-homoglutamine, 98%, N2-Benzyloxycarbonyl-L-homoglutamine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 1g, 500mg.
(2S)-6-amino-6-oxo-2-(phenylmethoxycarbonylamino)hexanoic acid (CAS 83793-19-5) is a chemical compound with the molecular formula C14H18N2O5 and a molecular weight of 294.30 g/mol. IUPAC name: (2S)-6-amino-6-oxo-2-(phenylmethoxycarbonylamino)hexanoic acid. InChIKey: DURMFLXRPFTILO-NSHDSACASA-N.
| Molecular formula | C14H18N2O5 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | (2S)-6-amino-6-oxo-2-(phenylmethoxycarbonylamino)hexanoic acid |
| InChIKey | DURMFLXRPFTILO-NSHDSACASA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CCCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)