Products 22839-61-8
CAS 22839-61-8 appears in our catalog under these names: Beta-aspartame, 95%, β-Asp-Phe methyl ester, 98%, β–Asp–Phe methyl ester, β-Asp-Phe methyl ester, L-β-Aspartyl-L-phenylalanine methyl ester, ≥96%, ≥96%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 25g, 10g, 50g, 100g, Get quote.
(2S)-2-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid (CAS 22839-61-8) is a chemical compound with the molecular formula C14H18N2O5 and a molecular weight of 294.30 g/mol. IUPAC name: (2S)-2-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid. InChIKey: SHHIPKDJQYIJJF-QWRGUYRKSA-N.
| Molecular formula | C14H18N2O5 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | (2S)-2-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| InChIKey | SHHIPKDJQYIJJF-QWRGUYRKSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
Beta-Aspartame, Aspartame, beta-, L-Phenylalanine, L-b-aspartyl-, 2-methyl ester, L-beta-Aspartyl-L-phenylalanine methyl ester, Beta-L-Aspartyl-L-phenylalanine methyl ether, ?-Asp-Phe methyl ester, .BETA.-ASPARTAME, 1-Methyl N-L-beta-aspartyl-3-phenyl-L-alaninate, beta-Asp-Phe methyl ester, 96%, SHHIPKDJQYIJJF-QWRGUYRKSA-N