Products 1980007-31-5
CAS 1980007-31-5 is the registry number for Cis-tert-butyl 3-(4-methoxy-3-nitrophenyl)-aziridine-2-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl (2S,3S)-3-(4-methoxy-3-nitrophenyl)aziridine-2-carboxylate (CAS 1980007-31-5) is a chemical compound with the molecular formula C14H18N2O5 and a molecular weight of 294.30 g/mol. IUPAC name: tert-butyl (2S,3S)-3-(4-methoxy-3-nitrophenyl)aziridine-2-carboxylate. InChIKey: PPPFTYSVHDNEKF-RYUDHWBXSA-N.
| Molecular formula | C14H18N2O5 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | tert-butyl (2S,3S)-3-(4-methoxy-3-nitrophenyl)aziridine-2-carboxylate |
| InChIKey | PPPFTYSVHDNEKF-RYUDHWBXSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1[C@@H](N1)C2=CC(=C(C=C2)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)