cas: 5619-09-0 — see every product listed under this CAS number, including other names
DL-Tryptophan methyl ester hydrochloride (CAS 5619-09-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 100g, 500g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | CM06730E-10g |
| cas | 5619-09-0 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 464.40 Pln | |
| Chemat | 1g | 129.43 Pln | |
| Chemat | 5g | 296.46 Pln | |
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 25g | 237.43 Pln | |
| Fluorochem | 100g | 612.30 Pln | |
| Fluorochem | 500g | 2247.14 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
Methyl 2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride (CAS 5619-09-0) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: methyl 2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride. InChIKey: XNFNGGQRDXFYMM-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | methyl 2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
| InChIKey | XNFNGGQRDXFYMM-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CNC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)