cas: 5619-09-0 — see every product listed under this CAS number, including other names
H-DL-Trp-OMe.HCl, 97%, 97% (CAS 5619-09-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PUO-1g |
| cas | 5619-09-0 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 102.80 Pln | |
| Chemat | 100g | 222.80 Pln | |
| Chemat | 500g | 854.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride (CAS 5619-09-0) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: methyl 2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride. InChIKey: XNFNGGQRDXFYMM-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | methyl 2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
| InChIKey | XNFNGGQRDXFYMM-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CNC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)