Desmethyl Ketoprofen 97%
cas: 22071-22-3 — see every product listed under this CAS number, including other names
Desmethyl Ketoprofen 97% (CAS 22071-22-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A121140-100mg |
| cas | 22071-22-3 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1065.69 Pln | |
| Ambeed | 5g | 3134.94 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A121140 |
2-(3-benzoylphenyl)acetic acid (CAS 22071-22-3) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: 2-(3-benzoylphenyl)acetic acid. InChIKey: ALDSXDRDRWDASQ-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 2-(3-benzoylphenyl)acetic acid |
| InChIKey | ALDSXDRDRWDASQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC(=C2)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Benzoylphenylacetic acid, 2-(3-Benzoylphenyl)acetic acid, (3-Benzoylphenyl)acetic acid, 3-Benzoylbenzeneacetic acid, KETOPROFEN IMPURITY B [EP IMPURITY], KETOPROFEN IMPURITY B (EP IMPURITY), ALDSXDRDRWDASQ-UHFFFAOYSA-N, Desmethyl Ketoprofen, Benzeneacetic acid, 3-benzoyl-, Ketoprofen EP Impurity B