cas: 69408-26-0 — see every product listed under this CAS number, including other names
Dibenzyl 2-aminopentanedioate, 97% (CAS 69408-26-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F626944-1G |
| cas | 69408-26-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1841.04 Pln | |
| Fluorochem | 5g | 5355.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Dibenzyl 2-aminopentanedioate (CAS 69408-26-0) is a chemical compound with the molecular formula C19H21NO4 and a molecular weight of 327.4 g/mol. IUPAC name: dibenzyl 2-aminopentanedioate. InChIKey: DHQUQYYPAWHGAR-UHFFFAOYSA-N.
| Molecular formula | C19H21NO4 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | dibenzyl 2-aminopentanedioate |
| InChIKey | DHQUQYYPAWHGAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCC(C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)