CAS 214221-37-1 is the registry number for Ethyl 4-(3,4-diacetyl-2,5-dimethyl-1H-pyrrol-1-yl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-(3,4-diacetyl-2,5-dimethylpyrrol-1-yl)benzoate (CAS 214221-37-1) is a chemical compound with the molecular formula C19H21NO4 and a molecular weight of 327.4 g/mol. IUPAC name: ethyl 4-(3,4-diacetyl-2,5-dimethylpyrrol-1-yl)benzoate. InChIKey: ZJWHZLONQIOJQX-UHFFFAOYSA-N.
| Molecular formula | C19H21NO4 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | ethyl 4-(3,4-diacetyl-2,5-dimethylpyrrol-1-yl)benzoate |
| InChIKey | ZJWHZLONQIOJQX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)N2C(=C(C(=C2C)C(=O)C)C(=O)C)C |
Computed by PubChem (NCBI)