CAS 23631-89-2 appears in our catalog under these names: Bpoc-ala-oh, 95%, Bpoc-Ala-OH, Bpoc–Ala–OH. Offered by: Combi-blocks, Creative Peptides, GLPBio. Available pack sizes: 1g, 250mg, 5g.
(2S)-2-[2-(4-phenylphenyl)propan-2-yloxycarbonylamino]propanoic acid (CAS 23631-89-2) is a chemical compound with the molecular formula C19H21NO4 and a molecular weight of 327.4 g/mol. IUPAC name: (2S)-2-[2-(4-phenylphenyl)propan-2-yloxycarbonylamino]propanoic acid. InChIKey: IZBDJSRNVBUKTE-ZDUSSCGKSA-N.
| Molecular formula | C19H21NO4 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | (2S)-2-[2-(4-phenylphenyl)propan-2-yloxycarbonylamino]propanoic acid |
| InChIKey | IZBDJSRNVBUKTE-ZDUSSCGKSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)OC(C)(C)C1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)