Products 1820687-23-7

CAS 1820687-23-7 is the registry number for methyl 2-(4-{[(tert-butoxy)carbonyl]amino}phenyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]benzoate (CAS 1820687-23-7) is a chemical compound with the molecular formula C19H21NO4 and a molecular weight of 327.4 g/mol. IUPAC name: methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]benzoate. InChIKey: OANRAUGBMCWBQZ-UHFFFAOYSA-N.

Identity
Molecular formulaC19H21NO4
Molecular weight327.4 g/mol
IUPAC namemethyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]benzoate
InChIKeyOANRAUGBMCWBQZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=CC=C(C=C1)C2=CC=CC=C2C(=O)OC

Computed by PubChem (NCBI)