CAS 252049-03-9 is the registry number for Fmoc–L–allo–threoninol. Offered by: GLPBio. Available pack sizes: 1g, 5g.
9H-fluoren-9-ylmethyl N-[(2R,3S)-1,3-dihydroxybutan-2-yl]carbamate (CAS 252049-03-9) is a chemical compound with the molecular formula C19H21NO4 and a molecular weight of 327.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2R,3S)-1,3-dihydroxybutan-2-yl]carbamate. InChIKey: YOKDHMTZJSRRIQ-KPZWWZAWSA-N.
| Molecular formula | C19H21NO4 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2R,3S)-1,3-dihydroxybutan-2-yl]carbamate |
| InChIKey | YOKDHMTZJSRRIQ-KPZWWZAWSA-N |
| SMILES | C[C@@H]([C@@H](CO)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)