CAS 143143-54-8 appears in our catalog under these names: Fmoc-d-allo-threoninol, 95%, Fmoc–D–allo–threoninol, (9H-Fluoren-9-yl)methyl ((2S,3R)-1,3-dihydroxybutan-2-yl)carbamate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
9H-fluoren-9-ylmethyl N-[(2S,3R)-1,3-dihydroxybutan-2-yl]carbamate (CAS 143143-54-8) is a chemical compound with the molecular formula C19H21NO4 and a molecular weight of 327.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2S,3R)-1,3-dihydroxybutan-2-yl]carbamate. InChIKey: YOKDHMTZJSRRIQ-XIKOKIGWSA-N.
| Molecular formula | C19H21NO4 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2S,3R)-1,3-dihydroxybutan-2-yl]carbamate |
| InChIKey | YOKDHMTZJSRRIQ-XIKOKIGWSA-N |
| SMILES | C[C@H]([C@H](CO)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)