Dibenzyl Dicarbona 97%
cas: 31139-36-3 — see every product listed under this CAS number, including other names
Dibenzyl Dicarbona 97% (CAS 31139-36-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A670916-1g |
| cas | 31139-36-3 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 542.81 Pln | |
| Ambeed | 10g | 1010.06 Pln | |
| Ambeed | 25g | 1955.69 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A670916 |
Benzyl phenylmethoxycarbonyl carbonate (CAS 31139-36-3) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: benzyl phenylmethoxycarbonyl carbonate. InChIKey: FHRRJZZGSJXPRQ-UHFFFAOYSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | benzyl phenylmethoxycarbonyl carbonate |
| InChIKey | FHRRJZZGSJXPRQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)OC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)