Dicyclohexyl carbonate, 95%
cas: 4427-97-8 — see every product listed under this CAS number, including other names
Dicyclohexyl carbonate, 95% (CAS 4427-97-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 100g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F689915-5G |
| cas | 4427-97-8 |
| size | 5g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 362.39 Pln | |
| Fluorochem | 10g | 523.79 Pln | |
| Fluorochem | 25g | 992.38 Pln | |
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 353.69 Pln | |
| Ambeed | 10g | 515.00 Pln | |
| Ambeed | 25g | 965.56 Pln | |
| Ambeed | 100g | 3118.25 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 222.80 Pln | |
| Chemat | 10g | 304.40 Pln | |
| Chemat | 25g | 544.40 Pln | |
| Chemat | 100g | 1782.80 Pln | |
| BLDpharm | 1g | 158.86 Pln | |
| BLDpharm | 5g | 375.45 Pln | |
| BLDpharm | 10g | 547.61 Pln | |
| BLDpharm | 25g | 1036.33 Pln | |
| BLDpharm | 100g | 3357.73 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Dicyclohexyl carbonate (CAS 4427-97-8) is a chemical compound with the molecular formula C13H22O3 and a molecular weight of 226.31 g/mol. IUPAC name: dicyclohexyl carbonate. InChIKey: FYIBPWZEZWVDQB-UHFFFAOYSA-N.
| Molecular formula | C13H22O3 |
|---|---|
| Molecular weight | 226.31 g/mol |
| IUPAC name | dicyclohexyl carbonate |
| InChIKey | FYIBPWZEZWVDQB-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)OC(=O)OC2CCCCC2 |
Computed by PubChem (NCBI)