Products 104779-75-1
CAS 104779-75-1 is the registry number for 2,2,8,8-Tetramethyl-3,5,7-nonanetrione. Offered by: TRC. Available pack sizes: 2,5g.
2,2,8,8-tetramethylnonane-3,5,7-trione (CAS 104779-75-1) is a chemical compound with the molecular formula C13H22O3 and a molecular weight of 226.31 g/mol. IUPAC name: 2,2,8,8-tetramethylnonane-3,5,7-trione. InChIKey: QPYLYMYYWNIHMD-UHFFFAOYSA-N.
| Molecular formula | C13H22O3 |
|---|---|
| Molecular weight | 226.31 g/mol |
| IUPAC name | 2,2,8,8-tetramethylnonane-3,5,7-trione |
| InChIKey | QPYLYMYYWNIHMD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CC(=O)CC(=O)C(C)(C)C |
Computed by PubChem (NCBI)