Products 1616705-59-9
CAS 1616705-59-9 is the registry number for tert–butyl (1R，3S)–3–acetyl–2，2–dimethylcyclobutane–1–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Cis-tert-butyl (1R,3S)-3-acetyl-2,2-dimethylcyclobutane-1-carboxylate (CAS 1616705-59-9) is a chemical compound with the molecular formula C13H22O3 and a molecular weight of 226.31 g/mol. IUPAC name: cis-tert-butyl (1R,3S)-3-acetyl-2,2-dimethylcyclobutane-1-carboxylate. InChIKey: WPGRNRNFZMZNFY-ZJUUUORDSA-N.
| Molecular formula | C13H22O3 |
|---|---|
| Molecular weight | 226.31 g/mol |
| IUPAC name | cis-tert-butyl (1R,3S)-3-acetyl-2,2-dimethylcyclobutane-1-carboxylate |
| InChIKey | WPGRNRNFZMZNFY-ZJUUUORDSA-N |
| SMILES | CC(=O)[C@H]1C[C@H](C1(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)