cas: 47230-38-6 — see every product listed under this CAS number, including other names
Diethyl [1,1'-biphenyl]-4,4'-dicarboxylate, 98%, 98% (CAS 47230-38-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PGD-250mg |
| cas | 47230-38-6 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 323.60 Pln | |
| Chemat | 5g | 789.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-(4-ethoxycarbonylphenyl)benzoate (CAS 47230-38-6) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: ethyl 4-(4-ethoxycarbonylphenyl)benzoate. InChIKey: SYTZNHBXNLYWAK-UHFFFAOYSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | ethyl 4-(4-ethoxycarbonylphenyl)benzoate |
| InChIKey | SYTZNHBXNLYWAK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)OCC |
Computed by PubChem (NCBI)