cas: 47230-38-6 — see every product listed under this CAS number, including other names
Diethyl 4,4'-Biphenyldicarboxylate, >98.0%(GC)(T) (CAS 47230-38-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B0831-1G |
| cas | 47230-38-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 555.98 Pln | |
| TCI | 5g | 2680.23 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
Ethyl 4-(4-ethoxycarbonylphenyl)benzoate (CAS 47230-38-6) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: ethyl 4-(4-ethoxycarbonylphenyl)benzoate. InChIKey: SYTZNHBXNLYWAK-UHFFFAOYSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | ethyl 4-(4-ethoxycarbonylphenyl)benzoate |
| InChIKey | SYTZNHBXNLYWAK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)OCC |
Computed by PubChem (NCBI)