cas: 10203-58-4 — see every product listed under this CAS number, including other names
Diethyl 2-isobutylmalonate, 98% (CAS 10203-58-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F448721-10G |
| cas | 10203-58-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 216.61 Pln | |
| Fluorochem | 100g | 638.33 Pln | |
| Fluorochem | 500g | 2970.85 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Diethyl 2-(2-methylpropyl)propanedioate (CAS 10203-58-4) is a chemical compound with the molecular formula C11H20O4 and a molecular weight of 216.27 g/mol. IUPAC name: diethyl 2-(2-methylpropyl)propanedioate. InChIKey: OFRFGNSZCYDFOH-UHFFFAOYSA-N.
| Molecular formula | C11H20O4 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | diethyl 2-(2-methylpropyl)propanedioate |
| InChIKey | OFRFGNSZCYDFOH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC(C)C)C(=O)OCC |
Computed by PubChem (NCBI)