cas: 10203-58-4 — see every product listed under this CAS number, including other names
Diethyl Isobutylmalonate, >98.0%(GC) (CAS 10203-58-4) is a chemical reagent available from Chemat. Available pack sizes: 25ml, 500ml. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | I0251-25ML |
| cas | 10203-58-4 |
| size | 25ml |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25ml | 305.20 Pln | |
| TCI | 500ml | 2719.57 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
Diethyl 2-(2-methylpropyl)propanedioate (CAS 10203-58-4) is a chemical compound with the molecular formula C11H20O4 and a molecular weight of 216.27 g/mol. IUPAC name: diethyl 2-(2-methylpropyl)propanedioate. InChIKey: OFRFGNSZCYDFOH-UHFFFAOYSA-N.
| Molecular formula | C11H20O4 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | diethyl 2-(2-methylpropyl)propanedioate |
| InChIKey | OFRFGNSZCYDFOH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC(C)C)C(=O)OCC |
Computed by PubChem (NCBI)