cas: 607-81-8 — see every product listed under this CAS number, including other names
Diethyl Benzylmalonate, >98.0%(GC) (CAS 607-81-8) is a chemical reagent available from Chemat. Available pack sizes: 25ml, 500ml. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B0423-25ML |
| cas | 607-81-8 |
| size | 25ml |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25ml | 241.28 Pln | |
| TCI | 500ml | 3004.77 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
Diethyl 2-benzylpropanedioate (CAS 607-81-8) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. IUPAC name: diethyl 2-benzylpropanedioate. InChIKey: ICZLTZWATFXDLP-UHFFFAOYSA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | diethyl 2-benzylpropanedioate |
| InChIKey | ICZLTZWATFXDLP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC1=CC=CC=C1)C(=O)OCC |
Computed by PubChem (NCBI)