Diethyl benzylmalonate, 98%
cas: 607-81-8 — see every product listed under this CAS number, including other names
Diethyl benzylmalonate, 98% (CAS 607-81-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A390976-5g |
| cas | 607-81-8 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 281.38 Pln | |
| Ambeed | 500g | 715.25 Pln | |
| Ambeed | 1kg | 1199.19 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 10g | 208.84 Pln | |
| BLDpharm | 25g | 236.61 Pln | |
| BLDpharm | 100g | 297.70 Pln | |
| BLDpharm | 500g | 703.11 Pln | |
| BLDpharm | 1kg | 1175.17 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Diethyl 2-benzylpropanedioate (CAS 607-81-8) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. IUPAC name: diethyl 2-benzylpropanedioate. InChIKey: ICZLTZWATFXDLP-UHFFFAOYSA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | diethyl 2-benzylpropanedioate |
| InChIKey | ICZLTZWATFXDLP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC1=CC=CC=C1)C(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
Diethyl benzylmalonate, Diethyl 2-benzylmalonate, diethyl 2-benzylpropanedioate, Benzylmalonic acid diethyl ester, Propanedioic acid, (phenylmethyl)-, diethyl ester, Malonic acid, benzyl-, diethyl ester, Malonic acid, 2-benzyl-, diethyl ester, 2-benzylmalonic acid diethyl ester, Propanedioic acid, 2-(phenylmethyl)-, 1,3-diethyl ester, (PHENYLMETHYL)PROPANEDIOIC ACID DIETHYL ESTER