cas: 5048-50-0 — see every product listed under this CAS number, including other names
Diethyl trans-4-Cyclohexene-1,2-dicarboxylate, >97.0%(GC) (CAS 5048-50-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C1704-1G |
| cas | 5048-50-0 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 108.51 Pln | |
| TCI | 5g | 300.28 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
Diethyl (1R,2R)-cyclohex-4-ene-1,2-dicarboxylate (CAS 5048-50-0) is a chemical compound with the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. IUPAC name: diethyl (1R,2R)-cyclohex-4-ene-1,2-dicarboxylate. InChIKey: OWVOHDKOANTMJU-NXEZZACHSA-N.
| Molecular formula | C12H18O4 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | diethyl (1R,2R)-cyclohex-4-ene-1,2-dicarboxylate |
| InChIKey | OWVOHDKOANTMJU-NXEZZACHSA-N |
| SMILES | CCOC(=O)[C@@H]1CC=CC[C@H]1C(=O)OCC |
Computed by PubChem (NCBI)