cas: 5048-50-0 — see every product listed under this CAS number, including other names
trans-Diethyl cyclohex-4-ene-1,2-dicarboxylate, 97%, 97% (CAS 5048-50-0) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PHI-200mg |
| cas | 5048-50-0 |
| size | 200mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 117.20 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 539.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Diethyl (1R,2R)-cyclohex-4-ene-1,2-dicarboxylate (CAS 5048-50-0) is a chemical compound with the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. IUPAC name: diethyl (1R,2R)-cyclohex-4-ene-1,2-dicarboxylate. InChIKey: OWVOHDKOANTMJU-NXEZZACHSA-N.
| Molecular formula | C12H18O4 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | diethyl (1R,2R)-cyclohex-4-ene-1,2-dicarboxylate |
| InChIKey | OWVOHDKOANTMJU-NXEZZACHSA-N |
| SMILES | CCOC(=O)[C@@H]1CC=CC[C@H]1C(=O)OCC |
Computed by PubChem (NCBI)