CAS 2221-66-1 appears in our catalog under these names: Dihydroseselin, Dihydroseselin/ 99.3% (existing batch purity), 8,8-Dimethyl-9,10-dihydropyrano[2,3-f]chromen-2(8H)-one, 97%, 97%, Dihydroseselin, 99.34%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg.
8,8-dimethyl-9,10-dihydropyrano[2,3-h]chromen-2-one (CAS 2221-66-1) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: 8,8-dimethyl-9,10-dihydropyrano[2,3-h]chromen-2-one. InChIKey: GXOXLDJHMAATRL-UHFFFAOYSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 8,8-dimethyl-9,10-dihydropyrano[2,3-h]chromen-2-one |
| InChIKey | GXOXLDJHMAATRL-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(O1)C=CC3=C2OC(=O)C=C3)C |
Computed by PubChem (NCBI)