cas: 35416-55-8 — see every product listed under this CAS number, including other names
Dimethyl 2,6-dihydroxyterephthalate 98+% (CAS 35416-55-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1472856-50mg |
| cas | 35416-55-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 248.00 Pln | |
| Ambeed | 100mg | 370.38 Pln | |
| Ambeed | 250mg | 609.56 Pln | |
| Ambeed | 1g | 1532.94 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1472856 |
Dimethyl 2,6-dihydroxybenzene-1,4-dicarboxylate (CAS 35416-55-8) is a chemical compound with the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. IUPAC name: dimethyl 2,6-dihydroxybenzene-1,4-dicarboxylate. InChIKey: NRLVOQTWTLHNPF-UHFFFAOYSA-N.
| Molecular formula | C10H10O6 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | dimethyl 2,6-dihydroxybenzene-1,4-dicarboxylate |
| InChIKey | NRLVOQTWTLHNPF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)O)C(=O)OC)O |
Computed by PubChem (NCBI)