cas: 7443-25-6 — see every product listed under this CAS number, including other names
Dimethyl 2-(4-methoxybenzylidene)malonate 98% (CAS 7443-25-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A878958-1g |
| cas | 7443-25-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 286.94 Pln | |
| Ambeed | 10g | 426.00 Pln | |
| Ambeed | 25g | 715.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A878958 |
Dimethyl 2-[(4-methoxyphenyl)methylidene]propanedioate (CAS 7443-25-6) is a chemical compound with the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. IUPAC name: dimethyl 2-[(4-methoxyphenyl)methylidene]propanedioate. InChIKey: JMFYZMAVUHNCPW-UHFFFAOYSA-N.
| Molecular formula | C13H14O5 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | dimethyl 2-[(4-methoxyphenyl)methylidene]propanedioate |
| InChIKey | JMFYZMAVUHNCPW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C=C(C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)