Products 60427-77-2

CAS 60427-77-2 is the registry number for 4-(4-Methoxybenzyl) itaconate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

4-[(4-methoxyphenyl)methoxy]-2-methylidene-4-oxobutanoic acid (CAS 60427-77-2) is a chemical compound with the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. IUPAC name: 4-[(4-methoxyphenyl)methoxy]-2-methylidene-4-oxobutanoic acid. InChIKey: RUWJSSDMIGOBCS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14O5
Molecular weight250.25 g/mol
IUPAC name4-[(4-methoxyphenyl)methoxy]-2-methylidene-4-oxobutanoic acid
InChIKeyRUWJSSDMIGOBCS-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)COC(=O)CC(=C)C(=O)O

Computed by PubChem (NCBI)