CAS 1883347-32-7 appears in our catalog under these names: 4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid, 95%, 4–Acetoxy–3–(cyclopropylmethoxy)benzoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
4-acetyloxy-3-(cyclopropylmethoxy)benzoic acid (CAS 1883347-32-7) is a chemical compound with the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. IUPAC name: 4-acetyloxy-3-(cyclopropylmethoxy)benzoic acid. InChIKey: FDEYOJNKVOZUEW-UHFFFAOYSA-N.
| Molecular formula | C13H14O5 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 4-acetyloxy-3-(cyclopropylmethoxy)benzoic acid |
| InChIKey | FDEYOJNKVOZUEW-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C(=O)O)OCC2CC2 |
Computed by PubChem (NCBI)