CAS 84182-46-7 appears in our catalog under these names: 3-(Benzyloxy)cyclobutane-1,1-dicarboxylic acid, 95%, 3-(Phenylmethoxy)-1,1-cyclobutanedicarboxylic acid, 97%, 97%, 3-(Phenylmethoxy)-1,1-cyclobutanedicarboxylic acid, 97%(HPLC),RG. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 500mg, 10g.
3-phenylmethoxycyclobutane-1,1-dicarboxylic acid (CAS 84182-46-7) is a chemical compound with the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. IUPAC name: 3-phenylmethoxycyclobutane-1,1-dicarboxylic acid. InChIKey: LYRCCQROQBVCRV-UHFFFAOYSA-N.
| Molecular formula | C13H14O5 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 3-phenylmethoxycyclobutane-1,1-dicarboxylic acid |
| InChIKey | LYRCCQROQBVCRV-UHFFFAOYSA-N |
| SMILES | C1C(CC1(C(=O)O)C(=O)O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)