Products 60943-40-0

CAS 60943-40-0 is the registry number for Ethyl 4-(3-methoxyphenyl)-2,4-dioxobutanoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 4-(3-methoxyphenyl)-2,4-dioxobutanoate (CAS 60943-40-0) is a chemical compound with the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. IUPAC name: ethyl 4-(3-methoxyphenyl)-2,4-dioxobutanoate. InChIKey: QUKANMABXJIQRZ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14O5
Molecular weight250.25 g/mol
IUPAC nameethyl 4-(3-methoxyphenyl)-2,4-dioxobutanoate
InChIKeyQUKANMABXJIQRZ-UHFFFAOYSA-N
SMILESCCOC(=O)C(=O)CC(=O)C1=CC(=CC=C1)OC

Computed by PubChem (NCBI)