CAS 1092348-87-2 appears in our catalog under these names: Methyl 6,7-dimethoxy-1-oxo-2,3-dihydro-1H-indene-4-carboxylate, 95%, Methyl 6,7–dimethoxy–1–oxo–2,3–dihydro–1H–indene–4–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
Methyl 6,7-dimethoxy-1-oxo-2,3-dihydroindene-4-carboxylate (CAS 1092348-87-2) is a chemical compound with the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. IUPAC name: methyl 6,7-dimethoxy-1-oxo-2,3-dihydroindene-4-carboxylate. InChIKey: ZDFLNOMIZLFVTQ-UHFFFAOYSA-N.
| Molecular formula | C13H14O5 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | methyl 6,7-dimethoxy-1-oxo-2,3-dihydroindene-4-carboxylate |
| InChIKey | ZDFLNOMIZLFVTQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(CCC2=O)C(=C1)C(=O)OC)OC |
Computed by PubChem (NCBI)