cas: 521980-84-7 — see every product listed under this CAS number, including other names
Dimethyl 2-chloropyridine-3,4-dicarboxylate, 97%, 97% (CAS 521980-84-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E8XQ-50mg |
| cas | 521980-84-7 |
| size | 50mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 366.80 Pln | |
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 861.20 Pln | |
| Chemat | 1g | 2128.40 Pln | |
| Chemat | 5g | 6856.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Dimethyl 2-chloropyridine-3,4-dicarboxylate (CAS 521980-84-7) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: dimethyl 2-chloropyridine-3,4-dicarboxylate. InChIKey: YFIVPCNBMBAUSK-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | dimethyl 2-chloropyridine-3,4-dicarboxylate |
| InChIKey | YFIVPCNBMBAUSK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NC=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)