Products 5174-32-3
CAS 5174-32-3 is the registry number for 2-Acetoxy-5-nitrobenzyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[2-(chloromethyl)-4-nitrophenyl] acetate (CAS 5174-32-3) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: [2-(chloromethyl)-4-nitrophenyl] acetate. InChIKey: XLEUIPVVUKAVGL-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | [2-(chloromethyl)-4-nitrophenyl] acetate |
| InChIKey | XLEUIPVVUKAVGL-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)[N+](=O)[O-])CCl |
Computed by PubChem (NCBI)
Synonyms:
Phenol, 2-(chloromethyl)-4-nitro-, acetate (ester), ANBC cpd, 2-(Chloromethyl)-4-nitrophenyl acetate, [2-(chloromethyl)-4-nitrophenyl] acetate, Phenol,2-(chloromethyl)-4-nitro-, acetate (ester) (9CI), o-Cresol, .alpha.-chloro-4-nitro-, acetate (ester), Tox21_302564, [2-(chloromethyl)-4-nitro-phenyl] acetate