CAS 99849-17-9 appears in our catalog under these names: 8-Chloromethyl-6-nitro-4h-benzo[1,3]dioxine, 98%, 8-(Chloromethyl)-6-nitro-2,4-dihydro-1,3-benzodioxine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
8-(chloromethyl)-6-nitro-4H-1,3-benzodioxine (CAS 99849-17-9) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: 8-(chloromethyl)-6-nitro-4H-1,3-benzodioxine. InChIKey: PSVFVAYNOKLOMR-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | 8-(chloromethyl)-6-nitro-4H-1,3-benzodioxine |
| InChIKey | PSVFVAYNOKLOMR-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)[N+](=O)[O-])CCl)OCO1 |
Computed by PubChem (NCBI)