CAS 73097-02-6 appears in our catalog under these names: Ethyl 2-chloro-4-nitrobenzoate, 95%, Ethyl 2-chloro-4-nitrobenzoate, 95%, 95%, Ethyl 2-chloro-4-nitrobenzoate, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg, 100g.
Ethyl 2-chloro-4-nitrobenzoate (CAS 73097-02-6) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: ethyl 2-chloro-4-nitrobenzoate. InChIKey: JFEBEHFIJNRGAT-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | ethyl 2-chloro-4-nitrobenzoate |
| InChIKey | JFEBEHFIJNRGAT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)