Products 521980-84-7
CAS 521980-84-7 appears in our catalog under these names: Dimethyl 2-chloropyridine-3,4-dicarboxylate, 95%, Dimethyl 2–chloropyridine–3，4–dicarboxylate, Dimethyl 2-chloropyridine-3,4-dicarboxylate 97%, Dimethyl 2-chloropyridine-3,4-dicarboxylate, 97%, 97%, Dimethyl 2-chloropyridine-3,4-dicarboxylate, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 50mg, 5g.
Dimethyl 2-chloropyridine-3,4-dicarboxylate (CAS 521980-84-7) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: dimethyl 2-chloropyridine-3,4-dicarboxylate. InChIKey: YFIVPCNBMBAUSK-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | dimethyl 2-chloropyridine-3,4-dicarboxylate |
| InChIKey | YFIVPCNBMBAUSK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NC=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)