CAS 859954-26-0 is the registry number for 2-(4-Nitrophenoxy)propanoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-(4-nitrophenoxy)propanoyl chloride (CAS 859954-26-0) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: 2-(4-nitrophenoxy)propanoyl chloride. InChIKey: IKYPKKNPZHHIJS-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | 2-(4-nitrophenoxy)propanoyl chloride |
| InChIKey | IKYPKKNPZHHIJS-UHFFFAOYSA-N |
| SMILES | CC(C(=O)Cl)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)