Products 859954-26-0

CAS 859954-26-0 is the registry number for 2-(4-Nitrophenoxy)propanoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(4-nitrophenoxy)propanoyl chloride (CAS 859954-26-0) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: 2-(4-nitrophenoxy)propanoyl chloride. InChIKey: IKYPKKNPZHHIJS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClNO4
Molecular weight229.62 g/mol
IUPAC name2-(4-nitrophenoxy)propanoyl chloride
InChIKeyIKYPKKNPZHHIJS-UHFFFAOYSA-N
SMILESCC(C(=O)Cl)OC1=CC=C(C=C1)[N+](=O)[O-]

Computed by PubChem (NCBI)