cas: 51832-31-6 — see every product listed under this CAS number, including other names
Dimethyl 4-aminophthalate, 95% (CAS 51832-31-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F236076-100MG |
| cas | 51832-31-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 893.45 Pln | |
| Fluorochem | 5g | 2512.67 Pln | |
| Fluorochem | 10g | 4032.97 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Dimethyl 4-aminobenzene-1,2-dicarboxylate (CAS 51832-31-6) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: dimethyl 4-aminobenzene-1,2-dicarboxylate. InChIKey: NTBHQNDXAJXRPU-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | dimethyl 4-aminobenzene-1,2-dicarboxylate |
| InChIKey | NTBHQNDXAJXRPU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)N)C(=O)OC |
Computed by PubChem (NCBI)