Dimethyl 4-aminophthalate, 98%
cas: 51832-31-6 — see every product listed under this CAS number, including other names
Dimethyl 4-aminophthalate, 98% (CAS 51832-31-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A107963-100mg |
| cas | 51832-31-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 837.62 Pln | |
| Ambeed | 5g | 2239.38 Pln | |
| Ambeed | 10g | 3719.00 Pln | |
| Ambeed | 25g | 7212.25 Pln | |
| Ambeed | 100g | 27148.25 Pln | |
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2046.80 Pln | |
| Chemat | 10g | 3894.80 Pln | |
| Chemat | 25g | 8579.60 Pln | |
| Chemat | 100g | 27323.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Dimethyl 4-aminobenzene-1,2-dicarboxylate (CAS 51832-31-6) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: dimethyl 4-aminobenzene-1,2-dicarboxylate. InChIKey: NTBHQNDXAJXRPU-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | dimethyl 4-aminobenzene-1,2-dicarboxylate |
| InChIKey | NTBHQNDXAJXRPU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)N)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Dimethyl 4-aminophthalate, 1,2-Benzenedicarboxylic acid, 4-amino-, dimethyl ester, methyl 2-methoxycarbonyl-4-aminobenzoate, Phthalic acid, 4-amino-, dimethyl ester, 4-Amino-phthalsaeuredimethylester, 4-Amino-phthalic acid, dimethyl ester, NTBHQNDXAJXRPU-UHFFFAOYSA-N, 1,2-Dimethyl 4-aminophthalate, dimethyl 4-aminobenzene-1,2-dicarboxylate, 4-aminophthalic acid dimethyl ester