CAS 1227945-05-2 appears in our catalog under these names: 2,5-Dimethyl 4-aminopyridine-2,5-dicarboxylate, Dimethyl 4-aminopyridine-2,5-dicarboxylate, 97%, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
Dimethyl 4-aminopyridine-2,5-dicarboxylate (CAS 1227945-05-2) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: dimethyl 4-aminopyridine-2,5-dicarboxylate. InChIKey: XJVKXMCHZIQXIV-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | dimethyl 4-aminopyridine-2,5-dicarboxylate |
| InChIKey | XJVKXMCHZIQXIV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C(C(=C1)N)C(=O)OC |
Computed by PubChem (NCBI)