CAS 588680-00-6 is the registry number for 2-(1,3-Benzodioxol-5-yloxy)acetohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(1,3-benzodioxol-5-yloxy)acetohydrazide (CAS 588680-00-6) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yloxy)acetohydrazide. InChIKey: NRQLPJMIINRJGJ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yloxy)acetohydrazide |
| InChIKey | NRQLPJMIINRJGJ-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)OCC(=O)NN |
Computed by PubChem (NCBI)