CAS 501030-96-2 appears in our catalog under these names: (S)-3-Amino-3-(4-nitro-phenyl)-propionic acid, 95%, (S)-3-Amino-3-(4-nitrophenyl)propanoic acid, 98%(HPLC),RG, 98%(HPLC),RG, (S)-3-Amino-3-(4-nitrophenyl)propanoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
(3S)-3-amino-3-(4-nitrophenyl)propanoic acid (CAS 501030-96-2) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: (3S)-3-amino-3-(4-nitrophenyl)propanoic acid. InChIKey: JVQPVKJZKRICRR-QMMMGPOBSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-nitrophenyl)propanoic acid |
| InChIKey | JVQPVKJZKRICRR-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CC(=O)O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)